C10H13NO — CID 10797090
5-methoxy-2-methyl-2,3-dihydro-1H-indole (PubChem CID 10797090) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-methoxy-2-methyl-2,3-dihydro-1H-indole.
| Compound Name | 5-methoxy-2-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 10797090 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 5-methoxy-2-methyl-2,3-dihydro-1H-indole |
| SMILES | COc1ccc2c(c1)CC(C)N2 |
| InChI | InChI=1S/C10H13NO/c1-7-5-8-6-9(12-2)3-4-10(8)11-7/h3-4,6-7,11H,5H2,1-2H3 |
| InChIKey | MKZAAOOSZBRZEP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|