C13H12FN3 — CID 113394357
7-[fluoro(pyrimidin-5-yl)methyl]-2,3-dihydro-1H-indole (PubChem CID 113394357) has the molecular formula C13H12FN3 and a molecular weight of 229.26 g/mol. Its IUPAC name is 7-[fluoro(pyrimidin-5-yl)methyl]-2,3-dihydro-1H-indole.
| Compound Name | 7-[fluoro(pyrimidin-5-yl)methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 113394357 |
| Molecular Formula | C13H12FN3 |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 7-[fluoro(pyrimidin-5-yl)methyl]-2,3-dihydro-1H-indole |
| SMILES | FC(c1cncnc1)c1cccc2c1NCC2 |
| InChI | InChI=1S/C13H12FN3/c14-12(10-6-15-8-16-7-10)11-3-1-2-9-4-5-17-13(9)11/h1-3,6-8,12,17H,4-5H2 |
| InChIKey | DBGCNLHYGWXNDP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |