C19H20FN — CID 116507150
7-[(4-cyclobutylphenyl)-fluoromethyl]-2,3-dihydro-1H-indole (PubChem CID 116507150) has the molecular formula C19H20FN and a molecular weight of 281.37 g/mol. Its IUPAC name is 7-[(4-cyclobutylphenyl)-fluoromethyl]-2,3-dihydro-1H-indole.
| Compound Name | 7-[(4-cyclobutylphenyl)-fluoromethyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116507150 |
| Molecular Formula | C19H20FN |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 7-[(4-cyclobutylphenyl)-fluoromethyl]-2,3-dihydro-1H-indole |
| SMILES | FC(c1ccc(C2CCC2)cc1)c1cccc2c1NCC2 |
| InChI | InChI=1S/C19H20FN/c20-18(17-6-2-5-16-11-12-21-19(16)17)15-9-7-14(8-10-15)13-3-1-4-13/h2,5-10,13,18,21H,1,3-4,11-12H2 |
| InChIKey | JRPVXVGAKNPPBI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |