C14H18FNO — CID 107138259
7-[fluoro(oxan-3-yl)methyl]-2,3-dihydro-1H-indole (PubChem CID 107138259) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 7-[fluoro(oxan-3-yl)methyl]-2,3-dihydro-1H-indole.
| Compound Name | 7-[fluoro(oxan-3-yl)methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 107138259 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 7-[fluoro(oxan-3-yl)methyl]-2,3-dihydro-1H-indole |
| SMILES | FC(c1cccc2c1NCC2)C1CCCOC1 |
| InChI | InChI=1S/C14H18FNO/c15-13(11-4-2-8-17-9-11)12-5-1-3-10-6-7-16-14(10)12/h1,3,5,11,13,16H,2,4,6-9H2 |
| InChIKey | BCNUGKRWEHXFMA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |