C33H23F9O — CID 154638177
4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-3-phenyl-7-phenylmethoxy-1,2-dihydronaphthalene (PubChem CID 154638177) has the molecular formula C33H23F9O and a molecular weight of 606.53 g/mol. Its IUPAC name is 4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-3-phenyl-7-phenylmethoxy-1,2-dihydronaphthalene.
| Compound Name | 4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-3-phenyl-7-phenylmethoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 154638177 |
| Molecular Formula | C33H23F9O |
| Molecular Weight | 606.53 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-3-phenyl-7-phenylmethoxy-1,2-dihydronaphthalene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(C2=C(c3ccccc3)CCc3cc(OCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C33H23F9O/c34-30(35,31(36,37)32(38,39)33(40,41)42)25-14-11-23(12-15-25)29-27(22-9-5-2-6-10-22)17-13-24-19-26(16-18-28(24)29)43-20-21-7-3-1-4-8-21/h1-12,14-16,18-19H,13,17,20H2 |
| InChIKey | XSFHQUBXXMUWFJ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.53 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|