C30H34N2O3 — CID 170706092
2-[4-(dimethoxymethyl)piperidin-1-yl]-5-(6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)pyridine (PubChem CID 170706092) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-[4-(dimethoxymethyl)piperidin-1-yl]-5-(6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)pyridine.
| Compound Name | 2-[4-(dimethoxymethyl)piperidin-1-yl]-5-(6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)pyridine |
|---|---|
| PubChem CID | 170706092 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 2-[4-(dimethoxymethyl)piperidin-1-yl]-5-(6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)pyridine |
| SMILES | COC(OC)C1CCN(c2ccc(C3=CCCc4cc(OCc5ccccc5)ccc43)cn2)CC1 |
| InChI | InChI=1S/C30H34N2O3/c1-33-30(34-2)23-15-17-32(18-16-23)29-14-11-25(20-31-29)27-10-6-9-24-19-26(12-13-28(24)27)35-21-22-7-4-3-5-8-22/h3-5,7-8,10-14,19-20,23,30H,6,9,15-18,21H2,1-2H3 |
| InChIKey | MFNNYZIGKKGDKL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|