C45H46N4O6 — CID 20634961
1,4-bis[5-(3,4-dimethoxy-5-phenylmethoxyphenyl)-2-pyridinyl]-1,4-diazepane (PubChem CID 20634961) has the molecular formula C45H46N4O6 and a molecular weight of 738.89 g/mol. Its IUPAC name is 1,4-bis[5-(3,4-dimethoxy-5-phenylmethoxyphenyl)-2-pyridinyl]-1,4-diazepane.
| Compound Name | 1,4-bis[5-(3,4-dimethoxy-5-phenylmethoxyphenyl)-2-pyridinyl]-1,4-diazepane |
|---|---|
| PubChem CID | 20634961 |
| Molecular Formula | C45H46N4O6 |
| Molecular Weight | 738.89 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | 1,4-bis[5-(3,4-dimethoxy-5-phenylmethoxyphenyl)-2-pyridinyl]-1,4-diazepane |
| SMILES | COc1cc(-c2ccc(N3CCCN(c4ccc(-c5cc(OC)c(OC)c(OCc6ccccc6)c5)cn4)CC3)nc2)cc(OCc2ccccc2)c1OC |
| InChI | InChI=1S/C45H46N4O6/c1-50-38-24-36(26-40(44(38)52-3)54-30-32-12-7-5-8-13-32)34-16-18-42(46-28-34)48-20-11-21-49(23-22-48)43-19-17-35(29-47-43)37-25-39(51-2)45(53-4)41(27-37)55-31-33-14-9-6-10-15-33/h5-10,12-19,24-29H,11,20-23,30-31H2,1-4H3 |
| InChIKey | RGNBGIXZKIFPBR-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |