C38H40FNO4 — CID 158789412
4-(dimethoxymethyl)-1-[4-[3-(3,4-dimethylphenyl)-7-phenylmethoxy-2H-chromen-4-yl]-2-fluorophenyl]piperidine (PubChem CID 158789412) has the molecular formula C38H40FNO4 and a molecular weight of 593.74 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1-[4-[3-(3,4-dimethylphenyl)-7-phenylmethoxy-2H-chromen-4-yl]-2-fluorophenyl]piperidine.
| Compound Name | 4-(dimethoxymethyl)-1-[4-[3-(3,4-dimethylphenyl)-7-phenylmethoxy-2H-chromen-4-yl]-2-fluorophenyl]piperidine |
|---|---|
| PubChem CID | 158789412 |
| Molecular Formula | C38H40FNO4 |
| Molecular Weight | 593.74 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | 4-(dimethoxymethyl)-1-[4-[3-(3,4-dimethylphenyl)-7-phenylmethoxy-2H-chromen-4-yl]-2-fluorophenyl]piperidine |
| SMILES | COC(OC)C1CCN(c2ccc(C3=C(c4ccc(C)c(C)c4)COc4cc(OCc5ccccc5)ccc43)cc2F)CC1 |
| InChI | InChI=1S/C38H40FNO4/c1-25-10-11-29(20-26(25)2)33-24-44-36-22-31(43-23-27-8-6-5-7-9-27)13-14-32(36)37(33)30-12-15-35(34(39)21-30)40-18-16-28(17-19-40)38(41-3)42-4/h5-15,20-22,28,38H,16-19,23-24H2,1-4H3 |
| InChIKey | NXKQNZPSQGIBNX-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.74 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|