C28H27FNO3+ — CID 175884371
4-(4-fluoro-3-methylphenyl)-3-(oxan-4-yl)-7-phenylmethoxy-1H-isoquinolin-2-ium 2-oxide (PubChem CID 175884371) has the molecular formula C28H27FNO3+ and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)-3-(oxan-4-yl)-7-phenylmethoxy-1H-isoquinolin-2-ium 2-oxide.
| Compound Name | 4-(4-fluoro-3-methylphenyl)-3-(oxan-4-yl)-7-phenylmethoxy-1H-isoquinolin-2-ium 2-oxide |
|---|---|
| PubChem CID | 175884371 |
| Molecular Formula | C28H27FNO3+ |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)-3-(oxan-4-yl)-7-phenylmethoxy-1H-isoquinolin-2-ium 2-oxide |
| SMILES | Cc1cc(C2=C(C3CCOCC3)[N+](=O)Cc3cc(OCc4ccccc4)ccc32)ccc1F |
| InChI | InChI=1S/C28H27FNO3/c1-19-15-22(7-10-26(19)29)27-25-9-8-24(33-18-20-5-3-2-4-6-20)16-23(25)17-30(31)28(27)21-11-13-32-14-12-21/h2-10,15-16,21H,11-14,17-18H2,1H3/q+1 |
| InChIKey | ZJNMBXBZSABHJL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|