C29H31FNO3+ — CID 156880293
ethane;4-(4-fluorophenyl)-2-hydroxy-3-(oxan-4-yl)-7-phenylmethoxyisoquinolin-2-ium (PubChem CID 156880293) has the molecular formula C29H31FNO3+ and a molecular weight of 460.57 g/mol. Its IUPAC name is ethane;4-(4-fluorophenyl)-2-hydroxy-3-(oxan-4-yl)-7-phenylmethoxyisoquinolin-2-ium.
| Compound Name | ethane;4-(4-fluorophenyl)-2-hydroxy-3-(oxan-4-yl)-7-phenylmethoxyisoquinolin-2-ium |
|---|---|
| PubChem CID | 156880293 |
| Molecular Formula | C29H31FNO3+ |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | ethane;4-(4-fluorophenyl)-2-hydroxy-3-(oxan-4-yl)-7-phenylmethoxyisoquinolin-2-ium |
| SMILES | CC.O[n+]1cc2cc(OCc3ccccc3)ccc2c(-c2ccc(F)cc2)c1C1CCOCC1 |
| InChI | InChI=1S/C27H25FNO3.C2H6/c28-23-8-6-20(7-9-23)26-25-11-10-24(32-18-19-4-2-1-3-5-19)16-22(25)17-29(30)27(26)21-12-14-31-15-13-21;1-2/h1-11,16-17,21,30H,12-15,18H2;1-2H3/q+1; |
| InChIKey | AFQIEGQLHJNKKP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|