C31H33FN3O+ — CID 156880054
1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(4-fluorophenyl)-7-phenylmethoxy-3-propan-2-ylisoquinoline (PubChem CID 156880054) has the molecular formula C31H33FN3O+ and a molecular weight of 482.62 g/mol. Its IUPAC name is 1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(4-fluorophenyl)-7-phenylmethoxy-3-propan-2-ylisoquinoline.
| Compound Name | 1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(4-fluorophenyl)-7-phenylmethoxy-3-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 156880054 |
| Molecular Formula | C31H33FN3O+ |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(4-fluorophenyl)-7-phenylmethoxy-3-propan-2-ylisoquinoline |
| SMILES | CC(C)c1nc([N+]23CCN(CC2)CC3)c2cc(OCc3ccccc3)ccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C31H33FN3O/c1-22(2)30-29(24-8-10-25(32)11-9-24)27-13-12-26(36-21-23-6-4-3-5-7-23)20-28(27)31(33-30)35-17-14-34(15-18-35)16-19-35/h3-13,20,22H,14-19,21H2,1-2H3/q+1 |
| InChIKey | PBQIZFFTCBLNIW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|