C33H34F2N3O2+ — CID 168754389
1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(3,4-difluorophenyl)-3-(oxan-4-yl)-8-phenylmethoxyisoquinoline (PubChem CID 168754389) has the molecular formula C33H34F2N3O2+ and a molecular weight of 542.65 g/mol. Its IUPAC name is 1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(3,4-difluorophenyl)-3-(oxan-4-yl)-8-phenylmethoxyisoquinoline.
| Compound Name | 1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(3,4-difluorophenyl)-3-(oxan-4-yl)-8-phenylmethoxyisoquinoline |
|---|---|
| PubChem CID | 168754389 |
| Molecular Formula | C33H34F2N3O2+ |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 1-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-(3,4-difluorophenyl)-3-(oxan-4-yl)-8-phenylmethoxyisoquinoline |
| SMILES | Fc1ccc(-c2c(C3CCOCC3)nc([N+]34CCN(CC3)CC4)c3c(OCc4ccccc4)cccc23)cc1F |
| InChI | InChI=1S/C33H34F2N3O2/c34-27-10-9-25(21-28(27)35)30-26-7-4-8-29(40-22-23-5-2-1-3-6-23)31(26)33(36-32(30)24-11-19-39-20-12-24)38-16-13-37(14-17-38)15-18-38/h1-10,21,24H,11-20,22H2/q+1 |
| InChIKey | XQPMQXAPMPFDLS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|