C34H33FN2O5S — CID 140899220
3-[[6-[4-(dimethoxymethyl)piperidin-1-yl]-3-pyridinyl]oxy]-2-(4-fluorophenyl)-6-phenylmethoxy-1-benzothiophene 1-oxide (PubChem CID 140899220) has the molecular formula C34H33FN2O5S and a molecular weight of 600.71 g/mol. Its IUPAC name is 3-[[6-[4-(dimethoxymethyl)piperidin-1-yl]-3-pyridinyl]oxy]-2-(4-fluorophenyl)-6-phenylmethoxy-1-benzothiophene 1-oxide.
| Compound Name | 3-[[6-[4-(dimethoxymethyl)piperidin-1-yl]-3-pyridinyl]oxy]-2-(4-fluorophenyl)-6-phenylmethoxy-1-benzothiophene 1-oxide |
|---|---|
| PubChem CID | 140899220 |
| Molecular Formula | C34H33FN2O5S |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 3-[[6-[4-(dimethoxymethyl)piperidin-1-yl]-3-pyridinyl]oxy]-2-(4-fluorophenyl)-6-phenylmethoxy-1-benzothiophene 1-oxide |
| SMILES | COC(OC)C1CCN(c2ccc(OC3=C(c4ccc(F)cc4)S(=O)c4cc(OCc5ccccc5)ccc43)cn2)CC1 |
| InChI | InChI=1S/C34H33FN2O5S/c1-39-34(40-2)25-16-18-37(19-17-25)31-15-13-28(21-36-31)42-32-29-14-12-27(41-22-23-6-4-3-5-7-23)20-30(29)43(38)33(32)24-8-10-26(35)11-9-24/h3-15,20-21,25,34H,16-19,22H2,1-2H3 |
| InChIKey | DVACGIVNSWHEJP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|