C32H27BrO6S — CID 142407659
ethyl 2-[[4-[[2-(4-bromophenyl)-1-oxo-6-phenylmethoxy-1-benzothiophen-3-yl]oxy]phenyl]methoxy]acetate (PubChem CID 142407659) has the molecular formula C32H27BrO6S and a molecular weight of 619.53 g/mol. Its IUPAC name is ethyl 2-[[4-[[2-(4-bromophenyl)-1-oxo-6-phenylmethoxy-1-benzothiophen-3-yl]oxy]phenyl]methoxy]acetate.
| Compound Name | ethyl 2-[[4-[[2-(4-bromophenyl)-1-oxo-6-phenylmethoxy-1-benzothiophen-3-yl]oxy]phenyl]methoxy]acetate |
|---|---|
| PubChem CID | 142407659 |
| Molecular Formula | C32H27BrO6S |
| Molecular Weight | 619.53 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | ethyl 2-[[4-[[2-(4-bromophenyl)-1-oxo-6-phenylmethoxy-1-benzothiophen-3-yl]oxy]phenyl]methoxy]acetate |
| SMILES | CCOC(=O)COCc1ccc(OC2=C(c3ccc(Br)cc3)S(=O)c3cc(OCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C32H27BrO6S/c1-2-37-30(34)21-36-19-23-8-14-26(15-9-23)39-31-28-17-16-27(38-20-22-6-4-3-5-7-22)18-29(28)40(35)32(31)24-10-12-25(33)13-11-24/h3-18H,2,19-21H2,1H3 |
| InChIKey | HLPHTVUYNSUSNQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|