C25H31NO3 — CID 162179807
(3S)-3-(2,2-dimethoxyethoxy)-1-[4-(6-methyl-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine (PubChem CID 162179807) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (3S)-3-(2,2-dimethoxyethoxy)-1-[4-(6-methyl-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine.
| Compound Name | (3S)-3-(2,2-dimethoxyethoxy)-1-[4-(6-methyl-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 162179807 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (3S)-3-(2,2-dimethoxyethoxy)-1-[4-(6-methyl-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine |
| SMILES | COC(CO[C@H]1CCN(c2ccc(C3=CCCc4cc(C)ccc43)cc2)C1)OC |
| InChI | InChI=1S/C25H31NO3/c1-18-7-12-24-20(15-18)5-4-6-23(24)19-8-10-21(11-9-19)26-14-13-22(16-26)29-17-25(27-2)28-3/h6-12,15,22,25H,4-5,13-14,16-17H2,1-3H3/t22-/m0/s1 |
| InChIKey | RHPJMJQUYLQRKS-QFIPXVFZSA-N |
| XLogP | 4.59 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|