C17H19ClN2O — CID 142522055
3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyaniline (PubChem CID 142522055) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is 3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyaniline.
| Compound Name | 3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyaniline |
|---|---|
| PubChem CID | 142522055 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyaniline |
| SMILES | Cc1ccc(N2CC[C@H](Oc3ccc(N)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C17H19ClN2O/c1-12-2-5-14(6-3-12)20-9-8-15(11-20)21-17-7-4-13(19)10-16(17)18/h2-7,10,15H,8-9,11,19H2,1H3/t15-/m0/s1 |
| InChIKey | UORGIZLVOMEQEQ-HNNXBMFYSA-N |
| XLogP | 3.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|