C17H18Cl2N2O — CID 137455260
3-chloro-4-[1-(4-chloro-3-methylphenyl)pyrrolidin-3-yl]oxyaniline (PubChem CID 137455260) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is 3-chloro-4-[1-(4-chloro-3-methylphenyl)pyrrolidin-3-yl]oxyaniline.
| Compound Name | 3-chloro-4-[1-(4-chloro-3-methylphenyl)pyrrolidin-3-yl]oxyaniline |
|---|---|
| PubChem CID | 137455260 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-chloro-4-[1-(4-chloro-3-methylphenyl)pyrrolidin-3-yl]oxyaniline |
| SMILES | Cc1cc(N2CCC(Oc3ccc(N)cc3Cl)C2)ccc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O/c1-11-8-13(3-4-15(11)18)21-7-6-14(10-21)22-17-5-2-12(20)9-16(17)19/h2-5,8-9,14H,6-7,10,20H2,1H3 |
| InChIKey | WIYSHDJLUVHRFX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|