C17H16ClF3N2O — CID 142522162
3-chloro-4-[(3S)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]oxyaniline (PubChem CID 142522162) has the molecular formula C17H16ClF3N2O and a molecular weight of 356.78 g/mol. Its IUPAC name is 3-chloro-4-[(3S)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]oxyaniline.
| Compound Name | 3-chloro-4-[(3S)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]oxyaniline |
|---|---|
| PubChem CID | 142522162 |
| Molecular Formula | C17H16ClF3N2O |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-chloro-4-[(3S)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]oxyaniline |
| SMILES | Nc1ccc(O[C@H]2CCN(c3cccc(C(F)(F)F)c3)C2)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClF3N2O/c18-15-9-12(22)4-5-16(15)24-14-6-7-23(10-14)13-3-1-2-11(8-13)17(19,20)21/h1-5,8-9,14H,6-7,10,22H2/t14-/m0/s1 |
| InChIKey | DYZHGRFAJQGYBS-AWEZNQCLSA-N |
| XLogP | 4.60 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|