C15H13F3N2 — CID 43175754
2-[3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-amine (PubChem CID 43175754) has the molecular formula C15H13F3N2 and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 43175754 |
| Molecular Formula | C15H13F3N2 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-1,3-dihydroisoindol-5-amine |
| SMILES | Nc1ccc2c(c1)CN(c1cccc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C15H13F3N2/c16-15(17,18)12-2-1-3-14(7-12)20-8-10-4-5-13(19)6-11(10)9-20/h1-7H,8-9,19H2 |
| InChIKey | XBKIIUXFIRDPHN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|