C25H30ClN3O3 — CID 137455285
(2R)-1-acetyl-N-[3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyphenyl]piperidine-2-carboxamide (PubChem CID 137455285) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is (2R)-1-acetyl-N-[3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyphenyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-acetyl-N-[3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyphenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 137455285 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (2R)-1-acetyl-N-[3-chloro-4-[(3S)-1-(4-methylphenyl)pyrrolidin-3-yl]oxyphenyl]piperidine-2-carboxamide |
| SMILES | CC(=O)N1CCCC[C@@H]1C(=O)Nc1ccc(O[C@H]2CCN(c3ccc(C)cc3)C2)c(Cl)c1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-17-6-9-20(10-7-17)28-14-12-21(16-28)32-24-11-8-19(15-22(24)26)27-25(31)23-5-3-4-13-29(23)18(2)30/h6-11,15,21,23H,3-5,12-14,16H2,1-2H3,(H,27,31)/t21-,23+/m0/s1 |
| InChIKey | FAXVLLPWFOIAFC-JTHBVZDNSA-N |
| XLogP | 4.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|