C27H26ClFN2O — CID 142351459
(3S)-1-[4-[2-(2-chloro-4-fluorophenyl)-7-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]pyrrolidin-3-amine (PubChem CID 142351459) has the molecular formula C27H26ClFN2O and a molecular weight of 448.97 g/mol. Its IUPAC name is (3S)-1-[4-[2-(2-chloro-4-fluorophenyl)-7-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[4-[2-(2-chloro-4-fluorophenyl)-7-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 142351459 |
| Molecular Formula | C27H26ClFN2O |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (3S)-1-[4-[2-(2-chloro-4-fluorophenyl)-7-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]pyrrolidin-3-amine |
| SMILES | COc1ccc2c(c1)C(c1ccc(N3CC[C@H](N)C3)cc1)=C(c1ccc(F)cc1Cl)CC2 |
| InChI | InChI=1S/C27H26ClFN2O/c1-32-22-9-4-17-5-10-24(23-11-6-19(29)14-26(23)28)27(25(17)15-22)18-2-7-21(8-3-18)31-13-12-20(30)16-31/h2-4,6-9,11,14-15,20H,5,10,12-13,16,30H2,1H3/t20-/m0/s1 |
| InChIKey | DJHDSBVRUUOUGG-FQEVSTJZSA-N |
| XLogP | 5.93 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|