C27H25NO5Se — CID 118717362
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzoselenophen-3-yl]-[4-(2-morpholin-4-ylethoxy)phenyl]methanone (PubChem CID 118717362) has the molecular formula C27H25NO5Se and a molecular weight of 522.46 g/mol. Its IUPAC name is [6-hydroxy-2-(4-hydroxyphenyl)-1-benzoselenophen-3-yl]-[4-(2-morpholin-4-ylethoxy)phenyl]methanone.
| Compound Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzoselenophen-3-yl]-[4-(2-morpholin-4-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 118717362 |
| Molecular Formula | C27H25NO5Se |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzoselenophen-3-yl]-[4-(2-morpholin-4-ylethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCCN2CCOCC2)cc1)c1c(-c2ccc(O)cc2)[se]c2cc(O)ccc12 |
| InChI | InChI=1S/C27H25NO5Se/c29-20-5-1-19(2-6-20)27-25(23-10-7-21(30)17-24(23)34-27)26(31)18-3-8-22(9-4-18)33-16-13-28-11-14-32-15-12-28/h1-10,17,29-30H,11-16H2 |
| InChIKey | VIEVETVKSQEPAT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|