C28H28FNO2S — CID 23656715
4-[8-fluoro-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1-benzothiepin-4-yl]phenol (PubChem CID 23656715) has the molecular formula C28H28FNO2S and a molecular weight of 461.60 g/mol. Its IUPAC name is 4-[8-fluoro-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1-benzothiepin-4-yl]phenol.
| Compound Name | 4-[8-fluoro-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1-benzothiepin-4-yl]phenol |
|---|---|
| PubChem CID | 23656715 |
| Molecular Formula | C28H28FNO2S |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 4-[8-fluoro-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-dihydro-1-benzothiepin-4-yl]phenol |
| SMILES | Oc1ccc(C2=C(c3ccc(OCCN4CCCC4)cc3)c3ccc(F)cc3SCC2)cc1 |
| InChI | InChI=1S/C28H28FNO2S/c29-22-7-12-26-27(19-22)33-18-13-25(20-3-8-23(31)9-4-20)28(26)21-5-10-24(11-6-21)32-17-16-30-14-1-2-15-30/h3-12,19,31H,1-2,13-18H2 |
| InChIKey | YTRBQFVSGXFIQA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|