C28H26F3NO4 — CID 10141600
3-(4-hydroxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol (PubChem CID 10141600) has the molecular formula C28H26F3NO4 and a molecular weight of 497.51 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 10141600 |
| Molecular Formula | C28H26F3NO4 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol |
| SMILES | Oc1ccc(C2=C(C(F)(F)F)c3ccc(O)cc3OC2c2ccc(OCCN3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H26F3NO4/c29-28(30,31)26-23-12-9-21(34)17-24(23)36-27(25(26)18-3-7-20(33)8-4-18)19-5-10-22(11-6-19)35-16-15-32-13-1-2-14-32/h3-12,17,27,33-34H,1-2,13-16H2 |
| InChIKey | VZDMZCPMVADPLB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|