C29H28F3NO4S — CID 10280589
3-(4-hydroxyphenyl)-2-[4-(3-thiomorpholin-4-ylpropoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol (PubChem CID 10280589) has the molecular formula C29H28F3NO4S and a molecular weight of 543.61 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-[4-(3-thiomorpholin-4-ylpropoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-2-[4-(3-thiomorpholin-4-ylpropoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 10280589 |
| Molecular Formula | C29H28F3NO4S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-[4-(3-thiomorpholin-4-ylpropoxy)phenyl]-4-(trifluoromethyl)-2H-chromen-7-ol |
| SMILES | Oc1ccc(C2=C(C(F)(F)F)c3ccc(O)cc3OC2c2ccc(OCCCN3CCSCC3)cc2)cc1 |
| InChI | InChI=1S/C29H28F3NO4S/c30-29(31,32)27-24-11-8-22(35)18-25(24)37-28(26(27)19-2-6-21(34)7-3-19)20-4-9-23(10-5-20)36-15-1-12-33-13-16-38-17-14-33/h2-11,18,28,34-35H,1,12-17H2 |
| InChIKey | URJOUKZGXZEIKK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|