C29H30FNO4 — CID 121423225
(2R)-4-ethyl-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2H-chromen-7-ol (PubChem CID 121423225) has the molecular formula C29H30FNO4 and a molecular weight of 475.56 g/mol. Its IUPAC name is (2R)-4-ethyl-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2H-chromen-7-ol.
| Compound Name | (2R)-4-ethyl-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 121423225 |
| Molecular Formula | C29H30FNO4 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (2R)-4-ethyl-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-hydroxyphenyl)-2H-chromen-7-ol |
| SMILES | CCC1=C(c2ccc(O)cc2)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C29H30FNO4/c1-2-25-26-12-9-23(33)15-27(26)35-29(28(25)20-3-7-22(32)8-4-20)21-5-10-24(11-6-21)34-14-13-31-17-19(16-30)18-31/h3-12,15,19,29,32-33H,2,13-14,16-18H2,1H3/t29-/m1/s1 |
| InChIKey | QAIPSDWVBXKGDS-GDLZYMKVSA-N |
| XLogP | 5.83 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|