C29H30FNO5S — CID 86764029
(2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-4-methyl-3-(3-methylsulfonylphenyl)-2H-chromen-7-ol (PubChem CID 86764029) has the molecular formula C29H30FNO5S and a molecular weight of 523.63 g/mol. Its IUPAC name is (2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-4-methyl-3-(3-methylsulfonylphenyl)-2H-chromen-7-ol.
| Compound Name | (2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-4-methyl-3-(3-methylsulfonylphenyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 86764029 |
| Molecular Formula | C29H30FNO5S |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-4-methyl-3-(3-methylsulfonylphenyl)-2H-chromen-7-ol |
| SMILES | CC1=C(c2cccc(S(C)(=O)=O)c2)[C@@H](c2ccc(OCCN3CC(CF)C3)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C29H30FNO5S/c1-19-26-11-8-23(32)15-27(26)36-29(28(19)22-4-3-5-25(14-22)37(2,33)34)21-6-9-24(10-7-21)35-13-12-31-17-20(16-30)18-31/h3-11,14-15,20,29,32H,12-13,16-18H2,1-2H3/t29-/m1/s1 |
| InChIKey | UJQUYXMXTFUIBJ-GDLZYMKVSA-N |
| XLogP | 5.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|