C35H45NO4Si — CID 16656741
4-[(2S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromen-3-yl]phenol (PubChem CID 16656741) has the molecular formula C35H45NO4Si and a molecular weight of 571.83 g/mol. Its IUPAC name is 4-[(2S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromen-3-yl]phenol.
| Compound Name | 4-[(2S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromen-3-yl]phenol |
|---|---|
| PubChem CID | 16656741 |
| Molecular Formula | C35H45NO4Si |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | 4-[(2S)-7-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromen-3-yl]phenol |
| SMILES | CC1=C(c2ccc(O)cc2)[C@H](c2ccc(OCCN3CCCCC3)cc2)Oc2cc(O[Si](C)(C)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C35H45NO4Si/c1-25-31-19-18-30(40-41(5,6)35(2,3)4)24-32(31)39-34(33(25)26-10-14-28(37)15-11-26)27-12-16-29(17-13-27)38-23-22-36-20-8-7-9-21-36/h10-19,24,34,37H,7-9,20-23H2,1-6H3/t34-/m0/s1 |
| InChIKey | SASJACBVSPDDIR-UMSFTDKQSA-N |
| XLogP | 8.71 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|