C36H45NO4Si — CID 69314333
tert-butyl-dimethyl-[[19-[4-(2-piperidin-1-ylethoxy)phenyl]-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12,14,16-heptaen-5-yl]oxy]silane (PubChem CID 69314333) has the molecular formula C36H45NO4Si and a molecular weight of 583.85 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[19-[4-(2-piperidin-1-ylethoxy)phenyl]-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12,14,16-heptaen-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[19-[4-(2-piperidin-1-ylethoxy)phenyl]-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12,14,16-heptaen-5-yl]oxy]silane |
|---|---|
| PubChem CID | 69314333 |
| Molecular Formula | C36H45NO4Si |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | tert-butyl-dimethyl-[[19-[4-(2-piperidin-1-ylethoxy)phenyl]-8,18-dioxatetracyclo[9.8.0.02,7.012,17]nonadeca-1(11),2(7),3,5,12,14,16-heptaen-5-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)OCCC1=C2C(c2ccc(OCCN3CCCCC3)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C36H45NO4Si/c1-36(2,3)42(4,5)41-28-17-18-31-33(25-28)39-23-19-30-29-11-7-8-12-32(29)40-35(34(30)31)26-13-15-27(16-14-26)38-24-22-37-20-9-6-10-21-37/h7-8,11-18,25,35H,6,9-10,19-24H2,1-5H3 |
| InChIKey | BHHRJILRPIFWBF-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|