C35H47NO2 — CID 143701534
1-[2-[4-[(2S)-4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]piperidine;ethane (PubChem CID 143701534) has the molecular formula C35H47NO2 and a molecular weight of 513.77 g/mol. Its IUPAC name is 1-[2-[4-[(2S)-4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]piperidine;ethane.
| Compound Name | 1-[2-[4-[(2S)-4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]piperidine;ethane |
|---|---|
| PubChem CID | 143701534 |
| Molecular Formula | C35H47NO2 |
| Molecular Weight | 513.77 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | 1-[2-[4-[(2S)-4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]piperidine;ethane |
| SMILES | CC.CC.CC1=C(c2ccc(C)cc2)[C@H](c2ccc(OCCN3CCCCC3)cc2)Oc2cc(C)ccc21 |
| InChI | InChI=1S/C31H35NO2.2C2H6/c1-22-7-10-25(11-8-22)30-24(3)28-16-9-23(2)21-29(28)34-31(30)26-12-14-27(15-13-26)33-20-19-32-17-5-4-6-18-32;2*1-2/h7-16,21,31H,4-6,17-20H2,1-3H3;2*1-2H3/t31-;;/m0../s1 |
| InChIKey | ZPGHFMODCDTMMO-ATQCJDTDSA-N |
| XLogP | 9.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.77 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|