C30H34NO2+ — CID 54023147
1-[2-[4-[4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]pyrrolidin-1-ium (PubChem CID 54023147) has the molecular formula C30H34NO2+ and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-[2-[4-[4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]pyrrolidin-1-ium.
| Compound Name | 1-[2-[4-[4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 54023147 |
| Molecular Formula | C30H34NO2+ |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 1-[2-[4-[4,7-dimethyl-3-(4-methylphenyl)-2H-chromen-2-yl]phenoxy]ethyl]pyrrolidin-1-ium |
| SMILES | CC1=C(c2ccc(C)cc2)C(c2ccc(OCC[NH+]3CCCC3)cc2)Oc2cc(C)ccc21 |
| InChI | InChI=1S/C30H33NO2/c1-21-6-9-24(10-7-21)29-23(3)27-15-8-22(2)20-28(27)33-30(29)25-11-13-26(14-12-25)32-19-18-31-16-4-5-17-31/h6-15,20,30H,4-5,16-19H2,1-3H3/p+1 |
| InChIKey | LAIKTHBKBRLCIK-UHFFFAOYSA-O |
| XLogP | 5.43 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|