C23H18F2O2 — CID 155589063
3-(3,5-difluorophenyl)-4-methyl-2-(4-methylphenyl)-2H-chromen-7-ol (PubChem CID 155589063) has the molecular formula C23H18F2O2 and a molecular weight of 364.39 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-4-methyl-2-(4-methylphenyl)-2H-chromen-7-ol.
| Compound Name | 3-(3,5-difluorophenyl)-4-methyl-2-(4-methylphenyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 155589063 |
| Molecular Formula | C23H18F2O2 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-(3,5-difluorophenyl)-4-methyl-2-(4-methylphenyl)-2H-chromen-7-ol |
| SMILES | CC1=C(c2cc(F)cc(F)c2)C(c2ccc(C)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C23H18F2O2/c1-13-3-5-15(6-4-13)23-22(16-9-17(24)11-18(25)10-16)14(2)20-8-7-19(26)12-21(20)27-23/h3-12,23,26H,1-2H3 |
| InChIKey | PIQSGUJWBVCUBY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|