About 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol
3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol (PubChem CID 145178984) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol.
Molecular Properties
| Compound Name | 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol |
| PubChem CID | 145178984 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol |
| SMILES | CC1=C(c2ccc(O)cc2)C(C)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C17H16O3/c1-10-15-8-7-14(19)9-16(15)20-11(2)17(10)12-3-5-13(18)6-4-12/h3-9,11,18-19H,1-2H3 |
| InChIKey | ILFPOEBBERETOR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol?
The IUPAC name of 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol (CID 145178984) is 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol.
What is the SMILES notation for 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol?
The canonical SMILES for 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol is CC1=C(c2ccc(O)cc2)C(C)Oc2cc(O)ccc21.
What is the InChIKey of 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol?
The InChIKey is ILFPOEBBERETOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-10-15-8-7-14(19)9-16(15)20-11(2)17(10)12-3-5-13(18)6-4-12/h3-9,11,18-19H,1-2H3.
What are the key properties of 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol?
3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol has a molecular weight of 268.31 g/mol, XLogP of 3.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxyphenyl)-2,4-dimethyl-2H-chromen-7-ol is sourced from PubChem (CID 145178984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).