C23H20O2 — CID 176984968
4-methyl-2-(4-methylphenyl)-3-phenyl-2H-chromen-7-ol (PubChem CID 176984968) has the molecular formula C23H20O2 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-methyl-2-(4-methylphenyl)-3-phenyl-2H-chromen-7-ol.
| Compound Name | 4-methyl-2-(4-methylphenyl)-3-phenyl-2H-chromen-7-ol |
|---|---|
| PubChem CID | 176984968 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-methyl-2-(4-methylphenyl)-3-phenyl-2H-chromen-7-ol |
| SMILES | CC1=C(c2ccccc2)C(c2ccc(C)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C23H20O2/c1-15-8-10-18(11-9-15)23-22(17-6-4-3-5-7-17)16(2)20-13-12-19(24)14-21(20)25-23/h3-14,23-24H,1-2H3 |
| InChIKey | NWFUFOIMSDYXPC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|