C29H29F2NO4 — CID 123793948
3-(2,3-difluoro-4-hydroxyphenyl)-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]phenyl]-2H-chromen-7-ol (PubChem CID 123793948) has the molecular formula C29H29F2NO4 and a molecular weight of 493.55 g/mol. Its IUPAC name is 3-(2,3-difluoro-4-hydroxyphenyl)-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]phenyl]-2H-chromen-7-ol.
| Compound Name | 3-(2,3-difluoro-4-hydroxyphenyl)-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]phenyl]-2H-chromen-7-ol |
|---|---|
| PubChem CID | 123793948 |
| Molecular Formula | C29H29F2NO4 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-(2,3-difluoro-4-hydroxyphenyl)-4-methyl-2-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]phenyl]-2H-chromen-7-ol |
| SMILES | CC1=C(c2ccc(O)c(F)c2F)C(c2ccc(OCCN3CCC(C)C3)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C29H29F2NO4/c1-17-11-12-32(16-17)13-14-35-21-6-3-19(4-7-21)29-26(23-9-10-24(34)28(31)27(23)30)18(2)22-8-5-20(33)15-25(22)36-29/h3-10,15,17,29,33-34H,11-14,16H2,1-2H3 |
| InChIKey | NZBHGFMRYNVWQC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|