C31H38FNO3 — CID 161163578
ethane;3-(fluoromethyl)-1-[2-[4-[(2S)-4-methyl-3-phenyl-2H-chromen-2-yl]phenoxy]ethyl]azetidine;methanol (PubChem CID 161163578) has the molecular formula C31H38FNO3 and a molecular weight of 491.65 g/mol. Its IUPAC name is ethane;3-(fluoromethyl)-1-[2-[4-[(2S)-4-methyl-3-phenyl-2H-chromen-2-yl]phenoxy]ethyl]azetidine;methanol.
| Compound Name | ethane;3-(fluoromethyl)-1-[2-[4-[(2S)-4-methyl-3-phenyl-2H-chromen-2-yl]phenoxy]ethyl]azetidine;methanol |
|---|---|
| PubChem CID | 161163578 |
| Molecular Formula | C31H38FNO3 |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | ethane;3-(fluoromethyl)-1-[2-[4-[(2S)-4-methyl-3-phenyl-2H-chromen-2-yl]phenoxy]ethyl]azetidine;methanol |
| SMILES | CC.CC1=C(c2ccccc2)[C@H](c2ccc(OCCN3CC(CF)C3)cc2)Oc2ccccc21.CO |
| InChI | InChI=1S/C28H28FNO2.C2H6.CH4O/c1-20-25-9-5-6-10-26(25)32-28(27(20)22-7-3-2-4-8-22)23-11-13-24(14-12-23)31-16-15-30-18-21(17-29)19-30;2*1-2/h2-14,21,28H,15-19H2,1H3;1-2H3;2H,1H3/t28-;;/m0../s1 |
| InChIKey | UQFUIMLHHXSKAG-ZXVJYWQYSA-N |
| XLogP | 6.67 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|