C29H41NO4Si — CID 58676723
(2R)-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-3-(2-trimethylsilylethoxymethyl)-2H-chromen-7-ol (PubChem CID 58676723) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is (2R)-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-3-(2-trimethylsilylethoxymethyl)-2H-chromen-7-ol.
| Compound Name | (2R)-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-3-(2-trimethylsilylethoxymethyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 58676723 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (2R)-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-3-(2-trimethylsilylethoxymethyl)-2H-chromen-7-ol |
| SMILES | CC1=C(COCC[Si](C)(C)C)[C@@H](c2ccc(OCCN3CCCCC3)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C29H41NO4Si/c1-22-26-13-10-24(31)20-28(26)34-29(27(22)21-32-18-19-35(2,3)4)23-8-11-25(12-9-23)33-17-16-30-14-6-5-7-15-30/h8-13,20,29,31H,5-7,14-19,21H2,1-4H3/t29-/m1/s1 |
| InChIKey | PAUMCYOKUFGQRG-GDLZYMKVSA-N |
| XLogP | 6.52 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|