C32H34N2O3S — CID 143084999
8-(dimethylaminosulfanyl)-5-[4-(2-piperidin-1-ylethoxy)phenyl]-5H-naphtho[1,2-c]chromen-2-ol (PubChem CID 143084999) has the molecular formula C32H34N2O3S and a molecular weight of 526.70 g/mol. Its IUPAC name is 8-(dimethylaminosulfanyl)-5-[4-(2-piperidin-1-ylethoxy)phenyl]-5H-naphtho[1,2-c]chromen-2-ol.
| Compound Name | 8-(dimethylaminosulfanyl)-5-[4-(2-piperidin-1-ylethoxy)phenyl]-5H-naphtho[1,2-c]chromen-2-ol |
|---|---|
| PubChem CID | 143084999 |
| Molecular Formula | C32H34N2O3S |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 8-(dimethylaminosulfanyl)-5-[4-(2-piperidin-1-ylethoxy)phenyl]-5H-naphtho[1,2-c]chromen-2-ol |
| SMILES | CN(C)Sc1ccc2c(c1)OC(c1ccc(OCCN3CCCCC3)cc1)c1c-2ccc2cc(O)ccc12 |
| InChI | InChI=1S/C32H34N2O3S/c1-33(2)38-26-12-15-28-29-13-8-23-20-24(35)9-14-27(23)31(29)32(37-30(28)21-26)22-6-10-25(11-7-22)36-19-18-34-16-4-3-5-17-34/h6-15,20-21,32,35H,3-5,16-19H2,1-2H3 |
| InChIKey | QAACOOQLCJYIPP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|