C28H29NO4 — CID 12017767
3-phenyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromene-5,7-diol (PubChem CID 12017767) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 3-phenyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromene-5,7-diol.
| Compound Name | 3-phenyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromene-5,7-diol |
|---|---|
| PubChem CID | 12017767 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 3-phenyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromene-5,7-diol |
| SMILES | Oc1cc(O)c2c(c1)OCC(c1ccccc1)=C2c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C28H29NO4/c30-22-17-25(31)28-26(18-22)33-19-24(20-7-3-1-4-8-20)27(28)21-9-11-23(12-10-21)32-16-15-29-13-5-2-6-14-29/h1,3-4,7-12,17-18,30-31H,2,5-6,13-16,19H2 |
| InChIKey | AUWJNTVAMMCLGJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|