C27H27NO3S — CID 53301526
2-(2-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1-benzothiophen-5-ol (PubChem CID 53301526) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1-benzothiophen-5-ol.
| Compound Name | 2-(2-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1-benzothiophen-5-ol |
|---|---|
| PubChem CID | 53301526 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-(2-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]-1-benzothiophen-5-ol |
| SMILES | Oc1ccc2sc(-c3ccccc3O)c(-c3ccc(OCCN4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C27H27NO3S/c29-20-10-13-25-23(18-20)26(27(32-25)22-6-2-3-7-24(22)30)19-8-11-21(12-9-19)31-17-16-28-14-4-1-5-15-28/h2-3,6-13,18,29-30H,1,4-5,14-17H2 |
| InChIKey | RZNIAKRFWKDGNV-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |