C53H48N2O7S2 — CID 142717327
bis[2-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone (PubChem CID 142717327) has the molecular formula C53H48N2O7S2 and a molecular weight of 889.11 g/mol. Its IUPAC name is bis[2-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone.
| Compound Name | bis[2-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 142717327 |
| Molecular Formula | C53H48N2O7S2 |
| Molecular Weight | 889.11 g/mol |
| Exact Mass | 888.29 |
| IUPAC Name | bis[2-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCCN2CCCC2)cc1-c1c(-c2ccc(O)cc2)sc2cc(O)ccc12)c1ccc(OCCN2CCCC2)cc1-c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C53H48N2O7S2/c56-35-9-5-33(6-10-35)52-49(43-17-13-37(58)29-47(43)63-52)45-31-39(61-27-25-54-21-1-2-22-54)15-19-41(45)51(60)42-20-16-40(62-28-26-55-23-3-4-24-55)32-46(42)50-44-18-14-38(59)30-48(44)64-53(50)34-7-11-36(57)12-8-34/h5-20,29-32,56-59H,1-4,21-28H2 |
| InChIKey | MCGQUIKUFZPBAA-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.11 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |