C18H21NO4 — CID 173275765
4-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]benzene-1,3-diol (PubChem CID 173275765) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]benzene-1,3-diol.
| Compound Name | 4-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]benzene-1,3-diol |
|---|---|
| PubChem CID | 173275765 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-[4-(2-pyrrolidin-1-ylethoxy)phenoxy]benzene-1,3-diol |
| SMILES | Oc1ccc(Oc2ccc(OCCN3CCCC3)cc2)c(O)c1 |
| InChI | InChI=1S/C18H21NO4/c20-14-3-8-18(17(21)13-14)23-16-6-4-15(5-7-16)22-12-11-19-9-1-2-10-19/h3-8,13,20-21H,1-2,9-12H2 |
| InChIKey | LCCCHGRDWTZFMV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |