C27H32N2O7 — CID 162676107
N-hydroxy-6-[5-hydroxy-4-oxo-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-7-yl]oxyhexanamide (PubChem CID 162676107) has the molecular formula C27H32N2O7 and a molecular weight of 496.56 g/mol. Its IUPAC name is N-hydroxy-6-[5-hydroxy-4-oxo-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-7-yl]oxyhexanamide.
| Compound Name | N-hydroxy-6-[5-hydroxy-4-oxo-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-7-yl]oxyhexanamide |
|---|---|
| PubChem CID | 162676107 |
| Molecular Formula | C27H32N2O7 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-hydroxy-6-[5-hydroxy-4-oxo-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-7-yl]oxyhexanamide |
| SMILES | O=C(CCCCCOc1cc(O)c2c(=O)cc(-c3ccc(OCCN4CCCC4)cc3)oc2c1)NO |
| InChI | InChI=1S/C27H32N2O7/c30-22-16-21(34-14-5-1-2-6-26(32)28-33)17-25-27(22)23(31)18-24(36-25)19-7-9-20(10-8-19)35-15-13-29-11-3-4-12-29/h7-10,16-18,30,33H,1-6,11-15H2,(H,28,32) |
| InChIKey | PTLTWXZCNRZPIP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|