C21H20O12 — CID 162820703
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxychromen-4-one (PubChem CID 162820703) has the molecular formula C21H20O12 and a molecular weight of 464.38 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxychromen-4-one |
|---|---|
| PubChem CID | 162820703 |
| Molecular Formula | C21H20O12 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxychromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc(OOC3OC(CO)C(O)C(O)C3O)cc(O)c12 |
| InChI | InChI=1S/C21H20O12/c22-7-16-18(27)19(28)20(29)21(31-16)33-32-9-4-12(25)17-13(26)6-14(30-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-6,16,18-25,27-29H,7H2 |
| InChIKey | YZDNFZZDMRGBRJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 199.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|