C23H24O12 — CID 91299726
5-hydroxy-7-methoxy-2-[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]chromen-4-one (PubChem CID 91299726) has the molecular formula C23H24O12 and a molecular weight of 492.43 g/mol. Its IUPAC name is 5-hydroxy-7-methoxy-2-[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]chromen-4-one.
| Compound Name | 5-hydroxy-7-methoxy-2-[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]chromen-4-one |
|---|---|
| PubChem CID | 91299726 |
| Molecular Formula | C23H24O12 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 5-hydroxy-7-methoxy-2-[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]chromen-4-one |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(OOC4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C23H24O12/c1-30-11-6-12(25)19-13(26)8-15(32-17(19)7-11)10-3-4-14(16(5-10)31-2)34-35-23-22(29)21(28)20(27)18(9-24)33-23/h3-8,18,20-25,27-29H,9H2,1-2H3/t18-,20-,21+,22-,23?/m1/s1 |
| InChIKey | KMYUIWGJKRYNPZ-HZKCKKNMSA-N |
| XLogP | 0.29 |
| TPSA | 177.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|