C23H24O13 — CID 163044488
2-[3,5-dimethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]-5,7-dihydroxychromen-4-one (PubChem CID 163044488) has the molecular formula C23H24O13 and a molecular weight of 508.43 g/mol. Its IUPAC name is 2-[3,5-dimethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]-5,7-dihydroxychromen-4-one.
| Compound Name | 2-[3,5-dimethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 163044488 |
| Molecular Formula | C23H24O13 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2-[3,5-dimethoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxyphenyl]-5,7-dihydroxychromen-4-one |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(OC)c1OOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C23H24O13/c1-31-15-3-9(13-7-12(27)18-11(26)5-10(25)6-14(18)33-13)4-16(32-2)22(15)35-36-23-21(30)20(29)19(28)17(8-24)34-23/h3-7,17,19-21,23-26,28-30H,8H2,1-2H3 |
| InChIKey | AEMNEPFYQOTILC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 197.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|