C25H25NO11 — CID 71723599
6-nitrooxyhexyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxy-4-oxochromen-7-yl]oxyacetate (PubChem CID 71723599) has the molecular formula C25H25NO11 and a molecular weight of 515.47 g/mol. Its IUPAC name is 6-nitrooxyhexyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxy-4-oxochromen-7-yl]oxyacetate.
| Compound Name | 6-nitrooxyhexyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxy-4-oxochromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 71723599 |
| Molecular Formula | C25H25NO11 |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 6-nitrooxyhexyl 2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-hydroxy-4-oxochromen-7-yl]oxyacetate |
| SMILES | O=C(COc1cc(O)c2c(=O)cc(-c3ccc4c(c3)OCCO4)oc2c1)OCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C25H25NO11/c27-18-12-17(35-15-24(29)34-7-3-1-2-4-8-36-26(30)31)13-23-25(18)19(28)14-21(37-23)16-5-6-20-22(11-16)33-10-9-32-20/h5-6,11-14,27H,1-4,7-10,15H2 |
| InChIKey | JOCZGATZURCUEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 156.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|