C26H26O8 — CID 67583945
ethyl 2-[2-(4-methoxyphenyl)-4-oxo-7-prop-2-enoxychromen-5-yl]oxyacetate;2H-oxete (PubChem CID 67583945) has the molecular formula C26H26O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is ethyl 2-[2-(4-methoxyphenyl)-4-oxo-7-prop-2-enoxychromen-5-yl]oxyacetate;2H-oxete.
| Compound Name | ethyl 2-[2-(4-methoxyphenyl)-4-oxo-7-prop-2-enoxychromen-5-yl]oxyacetate;2H-oxete |
|---|---|
| PubChem CID | 67583945 |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | ethyl 2-[2-(4-methoxyphenyl)-4-oxo-7-prop-2-enoxychromen-5-yl]oxyacetate;2H-oxete |
| SMILES | C1=COC1.C=CCOc1cc(OCC(=O)OCC)c2c(=O)cc(-c3ccc(OC)cc3)oc2c1 |
| InChI | InChI=1S/C23H22O7.C3H4O/c1-4-10-28-17-11-20(29-14-22(25)27-5-2)23-18(24)13-19(30-21(23)12-17)15-6-8-16(26-3)9-7-15;1-2-4-3-1/h4,6-9,11-13H,1,5,10,14H2,2-3H3;1-2H,3H2 |
| InChIKey | KWYSCNMZZMACFO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|