C27H19ClO8 — CID 110205902
3-(4-chlorophenyl)-5-hydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 110205902) has the molecular formula C27H19ClO8 and a molecular weight of 506.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-hydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 3-(4-chlorophenyl)-5-hydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 110205902 |
| Molecular Formula | C27H19ClO8 |
| Molecular Weight | 506.89 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 3-(4-chlorophenyl)-5-hydroxy-10-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1cc(C2CC(=O)Oc3cc(O)c4c(=O)c(-c5ccc(Cl)cc5)coc4c32)cc2c1OCCO2 |
| InChI | InChI=1S/C27H19ClO8/c1-32-20-8-14(9-21-26(20)34-7-6-33-21)16-10-22(30)36-19-11-18(29)24-25(31)17(12-35-27(24)23(16)19)13-2-4-15(28)5-3-13/h2-5,8-9,11-12,16,29H,6-7,10H2,1H3 |
| InChIKey | BQXCRGMFSCPDOG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|