C33H34O6 — CID 99983839
(2Z,9S)-2-[(4-methoxyphenyl)methylidene]-9-(4-octoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 99983839) has the molecular formula C33H34O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is (2Z,9S)-2-[(4-methoxyphenyl)methylidene]-9-(4-octoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-2-[(4-methoxyphenyl)methylidene]-9-(4-octoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 99983839 |
| Molecular Formula | C33H34O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (2Z,9S)-2-[(4-methoxyphenyl)methylidene]-9-(4-octoxyphenyl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | CCCCCCCCOc1ccc([C@@H]2CC(=O)Oc3ccc4c(c32)O/C(=C\c2ccc(OC)cc2)C4=O)cc1 |
| InChI | InChI=1S/C33H34O6/c1-3-4-5-6-7-8-19-37-25-15-11-23(12-16-25)27-21-30(34)38-28-18-17-26-32(35)29(39-33(26)31(27)28)20-22-9-13-24(36-2)14-10-22/h9-18,20,27H,3-8,19,21H2,1-2H3/b29-20-/t27-/m0/s1 |
| InChIKey | LAPCPOIGNFZSLB-UTDXIZSJSA-N |
| XLogP | 7.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|